C18H16O7S — CID 70181836
2-(benzenesulfinyl)-6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxybenzoic acid (PubChem CID 70181836) has the molecular formula C18H16O7S and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxybenzoic acid.
| Compound Name | 2-(benzenesulfinyl)-6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 70181836 |
| Molecular Formula | C18H16O7S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-(benzenesulfinyl)-6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxybenzoic acid |
| SMILES | COC=C(Oc1cccc(S(=O)c2ccccc2)c1C(=O)O)C(=O)OC |
| InChI | InChI=1S/C18H16O7S/c1-23-11-14(18(21)24-2)25-13-9-6-10-15(16(13)17(19)20)26(22)12-7-4-3-5-8-12/h3-11H,1-2H3,(H,19,20) |
| InChIKey | TURGBBYEWWNTBO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|