C19H23ClO8 — CID 70182506
tert-butyl 2-(acetyloxymethyl)-3-chloro-6-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate (PubChem CID 70182506) has the molecular formula C19H23ClO8 and a molecular weight of 414.84 g/mol. Its IUPAC name is tert-butyl 2-(acetyloxymethyl)-3-chloro-6-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate.
| Compound Name | tert-butyl 2-(acetyloxymethyl)-3-chloro-6-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 70182506 |
| Molecular Formula | C19H23ClO8 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | tert-butyl 2-(acetyloxymethyl)-3-chloro-6-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate |
| SMILES | CO/C=C(/Oc1ccc(Cl)c(COC(C)=O)c1C(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C19H23ClO8/c1-11(21)26-9-12-13(20)7-8-14(16(12)18(23)28-19(2,3)4)27-15(10-24-5)17(22)25-6/h7-8,10H,9H2,1-6H3/b15-10+ |
| InChIKey | UNZMFJCAHZGDIH-XNTDXEJSSA-N |
| XLogP | 3.40 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|