C26H36N2O7S — CID 139844319
[(2R)-2-hydroxy-1-[[(2R,3S)-5-morpholin-4-yl-3-phenylpentan-2-yl]oxycarbonylamino]-3-phenylpropyl] methanesulfonate (PubChem CID 139844319) has the molecular formula C26H36N2O7S and a molecular weight of 520.65 g/mol. Its IUPAC name is [(2R)-2-hydroxy-1-[[(2R,3S)-5-morpholin-4-yl-3-phenylpentan-2-yl]oxycarbonylamino]-3-phenylpropyl] methanesulfonate.
| Compound Name | [(2R)-2-hydroxy-1-[[(2R,3S)-5-morpholin-4-yl-3-phenylpentan-2-yl]oxycarbonylamino]-3-phenylpropyl] methanesulfonate |
|---|---|
| PubChem CID | 139844319 |
| Molecular Formula | C26H36N2O7S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [(2R)-2-hydroxy-1-[[(2R,3S)-5-morpholin-4-yl-3-phenylpentan-2-yl]oxycarbonylamino]-3-phenylpropyl] methanesulfonate |
| SMILES | C[C@@H](OC(=O)NC(OS(C)(=O)=O)[C@H](O)Cc1ccccc1)[C@@H](CCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C26H36N2O7S/c1-20(23(22-11-7-4-8-12-22)13-14-28-15-17-33-18-16-28)34-26(30)27-25(35-36(2,31)32)24(29)19-21-9-5-3-6-10-21/h3-12,20,23-25,29H,13-19H2,1-2H3,(H,27,30)/t20-,23-,24-,25?/m1/s1 |
| InChIKey | NJPSMYHVZHOJSW-ONPWFUERSA-N |
| XLogP | 2.51 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|