C28H35N3O5 — CID 139845580
(2E)-4-(azonan-1-yl)-4-oxo-2-[[4-[2-(1-pyridin-2-ylethylideneamino)oxyethoxy]phenyl]methylidene]butanoic acid (PubChem CID 139845580) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is (2E)-4-(azonan-1-yl)-4-oxo-2-[[4-[2-(1-pyridin-2-ylethylideneamino)oxyethoxy]phenyl]methylidene]butanoic acid.
| Compound Name | (2E)-4-(azonan-1-yl)-4-oxo-2-[[4-[2-(1-pyridin-2-ylethylideneamino)oxyethoxy]phenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 139845580 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (2E)-4-(azonan-1-yl)-4-oxo-2-[[4-[2-(1-pyridin-2-ylethylideneamino)oxyethoxy]phenyl]methylidene]butanoic acid |
| SMILES | CC(=NOCCOc1ccc(/C=C(\CC(=O)N2CCCCCCCC2)C(=O)O)cc1)c1ccccn1 |
| InChI | InChI=1S/C28H35N3O5/c1-22(26-10-6-7-15-29-26)30-36-19-18-35-25-13-11-23(12-14-25)20-24(28(33)34)21-27(32)31-16-8-4-2-3-5-9-17-31/h6-7,10-15,20H,2-5,8-9,16-19,21H2,1H3,(H,33,34)/b24-20+,30-22? |
| InChIKey | BUOGVUIQJUQZGF-GRTBRPCESA-N |
| XLogP | 4.94 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|