C50H30N4O10 — CID 139854815
[9-[3,6-bis(pyridine-2-carbonyloxy)-9H-xanthen-9-yl]-6-(pyridine-2-carbonyloxy)-9H-xanthen-3-yl] pyridine-2-carboxylate (PubChem CID 139854815) has the molecular formula C50H30N4O10 and a molecular weight of 846.81 g/mol. Its IUPAC name is [9-[3,6-bis(pyridine-2-carbonyloxy)-9H-xanthen-9-yl]-6-(pyridine-2-carbonyloxy)-9H-xanthen-3-yl] pyridine-2-carboxylate.
| Compound Name | [9-[3,6-bis(pyridine-2-carbonyloxy)-9H-xanthen-9-yl]-6-(pyridine-2-carbonyloxy)-9H-xanthen-3-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 139854815 |
| Molecular Formula | C50H30N4O10 |
| Molecular Weight | 846.81 g/mol |
| Exact Mass | 846.20 |
| IUPAC Name | [9-[3,6-bis(pyridine-2-carbonyloxy)-9H-xanthen-9-yl]-6-(pyridine-2-carbonyloxy)-9H-xanthen-3-yl] pyridine-2-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)Oc1cc(OC(=O)c3ccccn3)ccc1C2C1c2ccc(OC(=O)c3ccccn3)cc2Oc2cc(OC(=O)c3ccccn3)ccc21)c1ccccn1 |
| InChI | InChI=1S/C50H30N4O10/c55-47(37-9-1-5-21-51-37)59-29-13-17-33-41(25-29)63-42-26-30(60-48(56)38-10-2-6-22-52-38)14-18-34(42)45(33)46-35-19-15-31(61-49(57)39-11-3-7-23-53-39)27-43(35)64-44-28-32(16-20-36(44)46)62-50(58)40-12-4-8-24-54-40/h1-28,45-46H |
| InChIKey | UWGWXBIFFJYGGE-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 175.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.81 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|