C5H7F2N — CID 139880335
1-(difluoromethyl)-2,5-dihydropyrrole (PubChem CID 139880335) has the molecular formula C5H7F2N and a molecular weight of 119.11 g/mol. Its IUPAC name is 1-(difluoromethyl)-2,5-dihydropyrrole.
| Compound Name | 1-(difluoromethyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 139880335 |
| Molecular Formula | C5H7F2N |
| Molecular Weight | 119.11 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | 1-(difluoromethyl)-2,5-dihydropyrrole |
| SMILES | FC(F)N1CC=CC1 |
| InChI | InChI=1S/C5H7F2N/c6-5(7)8-3-1-2-4-8/h1-2,5H,3-4H2 |
| InChIKey | YAMDVENFKHRKCG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.11 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|