C6H6F6NW- — CID 58019324
(E)-N,N-bis(trifluoromethyl)but-2-en-1-amine;tungsten (PubChem CID 58019324) has the molecular formula C6H6F6NW- and a molecular weight of 389.95 g/mol. Its IUPAC name is (E)-N,N-bis(trifluoromethyl)but-2-en-1-amine;tungsten.
| Compound Name | (E)-N,N-bis(trifluoromethyl)but-2-en-1-amine;tungsten |
|---|---|
| PubChem CID | 58019324 |
| Molecular Formula | C6H6F6NW- |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | (E)-N,N-bis(trifluoromethyl)but-2-en-1-amine;tungsten |
| SMILES | [CH2-]/C=C/CN(C(F)(F)F)C(F)(F)F.[W] |
| InChI | InChI=1S/C6H6F6N.W/c1-2-3-4-13(5(7,8)9)6(10,11)12;/h2-3H,1,4H2;/q-1;/b3-2+; |
| InChIKey | QFIGXJHEOUEEMF-SQQVDAMQSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|