C6H7F6N — CID 58019325
(E)-N,N-bis(trifluoromethyl)but-2-en-1-amine (PubChem CID 58019325) has the molecular formula C6H7F6N and a molecular weight of 207.12 g/mol. Its IUPAC name is (E)-N,N-bis(trifluoromethyl)but-2-en-1-amine.
| Compound Name | (E)-N,N-bis(trifluoromethyl)but-2-en-1-amine |
|---|---|
| PubChem CID | 58019325 |
| Molecular Formula | C6H7F6N |
| Molecular Weight | 207.12 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (E)-N,N-bis(trifluoromethyl)but-2-en-1-amine |
| SMILES | C/C=C/CN(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F6N/c1-2-3-4-13(5(7,8)9)6(10,11)12/h2-3H,4H2,1H3/b3-2+ |
| InChIKey | LIBCAVSREBGYIU-NSCUHMNNSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.12 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|