C28H33N5O3S — CID 139880563
7-[6-(1-ethanimidoylpyrrolidin-3-yl)oxy-1-ethylsulfonyl-3,4-dihydro-2H-quinolin-2-yl]naphthalene-2-carboximidamide (PubChem CID 139880563) has the molecular formula C28H33N5O3S and a molecular weight of 519.67 g/mol. Its IUPAC name is 7-[6-(1-ethanimidoylpyrrolidin-3-yl)oxy-1-ethylsulfonyl-3,4-dihydro-2H-quinolin-2-yl]naphthalene-2-carboximidamide.
| Compound Name | 7-[6-(1-ethanimidoylpyrrolidin-3-yl)oxy-1-ethylsulfonyl-3,4-dihydro-2H-quinolin-2-yl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 139880563 |
| Molecular Formula | C28H33N5O3S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 7-[6-(1-ethanimidoylpyrrolidin-3-yl)oxy-1-ethylsulfonyl-3,4-dihydro-2H-quinolin-2-yl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2ccc(C3CCc4cc(OC5CCN(/C(C)=N/[H])C5)ccc4N3S(=O)(=O)CC)cc2c1 |
| InChI | InChI=1S/C28H33N5O3S/c1-3-37(34,35)33-26(20-6-4-19-5-7-22(28(30)31)15-23(19)14-20)10-8-21-16-24(9-11-27(21)33)36-25-12-13-32(17-25)18(2)29/h4-7,9,11,14-16,25-26,29H,3,8,10,12-13,17H2,1-2H3,(H3,30,31)/b29-18+ |
| InChIKey | VMDUBGIWCOMIEJ-RDRPBHBLSA-N |
| XLogP | 4.42 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|