C26H32Cl2N4O3S — CID 139880602
7-[1-ethylsulfonyl-5-[[(2R)-pyrrolidin-2-yl]methoxy]-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride (PubChem CID 139880602) has the molecular formula C26H32Cl2N4O3S and a molecular weight of 551.54 g/mol. Its IUPAC name is 7-[1-ethylsulfonyl-5-[[(2R)-pyrrolidin-2-yl]methoxy]-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride.
| Compound Name | 7-[1-ethylsulfonyl-5-[[(2R)-pyrrolidin-2-yl]methoxy]-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 139880602 |
| Molecular Formula | C26H32Cl2N4O3S |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 7-[1-ethylsulfonyl-5-[[(2R)-pyrrolidin-2-yl]methoxy]-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2ccc(C3Cc4cc(OC[C@H]5CCCN5)ccc4N3S(=O)(=O)CC)cc2c1 |
| InChI | InChI=1S/C26H30N4O3S.2ClH/c1-2-34(31,32)30-24-10-9-23(33-16-22-4-3-11-29-22)14-21(24)15-25(30)18-7-5-17-6-8-19(26(27)28)13-20(17)12-18;;/h5-10,12-14,22,25,29H,2-4,11,15-16H2,1H3,(H3,27,28);2*1H/t22-,25?;;/m1../s1 |
| InChIKey | CQPUZZJZDZIXEI-NQDROUOWSA-N |
| XLogP | 4.55 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|