C28H35Cl2N5O3S — CID 139880575
7-[5-[[(2R)-1-ethanimidoylpyrrolidin-2-yl]methoxy]-1-ethylsulfonyl-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride (PubChem CID 139880575) has the molecular formula C28H35Cl2N5O3S and a molecular weight of 592.59 g/mol. Its IUPAC name is 7-[5-[[(2R)-1-ethanimidoylpyrrolidin-2-yl]methoxy]-1-ethylsulfonyl-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride.
| Compound Name | 7-[5-[[(2R)-1-ethanimidoylpyrrolidin-2-yl]methoxy]-1-ethylsulfonyl-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 139880575 |
| Molecular Formula | C28H35Cl2N5O3S |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | 7-[5-[[(2R)-1-ethanimidoylpyrrolidin-2-yl]methoxy]-1-ethylsulfonyl-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2ccc(C3Cc4cc(OC[C@H]5CCCN5/C(C)=N/[H])ccc4N3S(=O)(=O)CC)cc2c1 |
| InChI | InChI=1S/C28H33N5O3S.2ClH/c1-3-37(34,35)33-26-11-10-25(36-17-24-5-4-12-32(24)18(2)29)15-23(26)16-27(33)20-8-6-19-7-9-21(28(30)31)14-22(19)13-20;;/h6-11,13-15,24,27,29H,3-5,12,16-17H2,1-2H3,(H3,30,31);2*1H/b29-18+;;/t24-,27?;;/m1../s1 |
| InChIKey | YKRTYCMIOZXNED-ANABMBCZSA-N |
| XLogP | 5.26 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|