C28H35N5O6S — CID 135794249
ethyl 2-[[2-[(E)-2-(5-carbamimidoyl-2-hydroxyphenyl)ethenyl]-5-(1-ethanimidoylpiperidin-4-yl)oxy-2,3-dihydroindol-1-yl]sulfonyl]acetate (PubChem CID 135794249) has the molecular formula C28H35N5O6S and a molecular weight of 569.68 g/mol. Its IUPAC name is ethyl 2-[[2-[(E)-2-(5-carbamimidoyl-2-hydroxyphenyl)ethenyl]-5-(1-ethanimidoylpiperidin-4-yl)oxy-2,3-dihydroindol-1-yl]sulfonyl]acetate.
| Compound Name | ethyl 2-[[2-[(E)-2-(5-carbamimidoyl-2-hydroxyphenyl)ethenyl]-5-(1-ethanimidoylpiperidin-4-yl)oxy-2,3-dihydroindol-1-yl]sulfonyl]acetate |
|---|---|
| PubChem CID | 135794249 |
| Molecular Formula | C28H35N5O6S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | ethyl 2-[[2-[(E)-2-(5-carbamimidoyl-2-hydroxyphenyl)ethenyl]-5-(1-ethanimidoylpiperidin-4-yl)oxy-2,3-dihydroindol-1-yl]sulfonyl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(O)c(/C=C/C2Cc3cc(OC4CCN(/C(C)=N/[H])CC4)ccc3N2S(=O)(=O)CC(=O)OCC)c1 |
| InChI | InChI=1S/C28H35N5O6S/c1-3-38-27(35)17-40(36,37)33-22(6-4-19-14-20(28(30)31)5-9-26(19)34)15-21-16-24(7-8-25(21)33)39-23-10-12-32(13-11-23)18(2)29/h4-9,14,16,22-23,29,34H,3,10-13,15,17H2,1-2H3,(H3,30,31)/b6-4+,29-18+ |
| InChIKey | XJUWUQDIVVPXJG-LBCCILSTSA-N |
| XLogP | 2.85 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|