C26H31FN4O5S — CID 23661243
ethyl 2-[[2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-4-fluoro-5-piperidin-4-yloxy-2,3-dihydroindol-1-yl]sulfonyl]acetate (PubChem CID 23661243) has the molecular formula C26H31FN4O5S and a molecular weight of 530.62 g/mol. Its IUPAC name is ethyl 2-[[2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-4-fluoro-5-piperidin-4-yloxy-2,3-dihydroindol-1-yl]sulfonyl]acetate.
| Compound Name | ethyl 2-[[2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-4-fluoro-5-piperidin-4-yloxy-2,3-dihydroindol-1-yl]sulfonyl]acetate |
|---|---|
| PubChem CID | 23661243 |
| Molecular Formula | C26H31FN4O5S |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | ethyl 2-[[2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-4-fluoro-5-piperidin-4-yloxy-2,3-dihydroindol-1-yl]sulfonyl]acetate |
| SMILES | [H]/N=C(\N)c1cccc(/C=C/C2Cc3c(ccc(OC4CCNCC4)c3F)N2S(=O)(=O)CC(=O)OCC)c1 |
| InChI | InChI=1S/C26H31FN4O5S/c1-2-35-24(32)16-37(33,34)31-19(7-6-17-4-3-5-18(14-17)26(28)29)15-21-22(31)8-9-23(25(21)27)36-20-10-12-30-13-11-20/h3-9,14,19-20,30H,2,10-13,15-16H2,1H3,(H3,28,29)/b7-6+ |
| InChIKey | WRBCRVUAYPKUIW-VOTSOKGWSA-N |
| XLogP | 2.58 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|