C29H36N4O7S — CID 23661246
ethyl 2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-1-(2-ethoxy-2-oxoethyl)sulfonyl-5-piperidin-4-yloxy-2,3-dihydroindole-6-carboxylate (PubChem CID 23661246) has the molecular formula C29H36N4O7S and a molecular weight of 584.70 g/mol. Its IUPAC name is ethyl 2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-1-(2-ethoxy-2-oxoethyl)sulfonyl-5-piperidin-4-yloxy-2,3-dihydroindole-6-carboxylate.
| Compound Name | ethyl 2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-1-(2-ethoxy-2-oxoethyl)sulfonyl-5-piperidin-4-yloxy-2,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 23661246 |
| Molecular Formula | C29H36N4O7S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | ethyl 2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-1-(2-ethoxy-2-oxoethyl)sulfonyl-5-piperidin-4-yloxy-2,3-dihydroindole-6-carboxylate |
| SMILES | [H]/N=C(\N)c1cccc(/C=C/C2Cc3cc(OC4CCNCC4)c(C(=O)OCC)cc3N2S(=O)(=O)CC(=O)OCC)c1 |
| InChI | InChI=1S/C29H36N4O7S/c1-3-38-27(34)18-41(36,37)33-22(9-8-19-6-5-7-20(14-19)28(30)31)15-21-16-26(40-23-10-12-32-13-11-23)24(17-25(21)33)29(35)39-4-2/h5-9,14,16-17,22-23,32H,3-4,10-13,15,18H2,1-2H3,(H3,30,31)/b9-8+ |
| InChIKey | IIQWWXHWXCTHQD-CMDGGOBGSA-N |
| XLogP | 2.62 |
| TPSA | 161.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|