C28H34ClN5O5S — CID 23659387
ethyl 2-[[2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-6-chloro-5-(1-ethanimidoylpiperidin-4-yl)oxy-2,3-dihydroindol-1-yl]sulfonyl]acetate (PubChem CID 23659387) has the molecular formula C28H34ClN5O5S and a molecular weight of 588.13 g/mol. Its IUPAC name is ethyl 2-[[2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-6-chloro-5-(1-ethanimidoylpiperidin-4-yl)oxy-2,3-dihydroindol-1-yl]sulfonyl]acetate.
| Compound Name | ethyl 2-[[2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-6-chloro-5-(1-ethanimidoylpiperidin-4-yl)oxy-2,3-dihydroindol-1-yl]sulfonyl]acetate |
|---|---|
| PubChem CID | 23659387 |
| Molecular Formula | C28H34ClN5O5S |
| Molecular Weight | 588.13 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | ethyl 2-[[2-[(E)-2-(3-carbamimidoylphenyl)ethenyl]-6-chloro-5-(1-ethanimidoylpiperidin-4-yl)oxy-2,3-dihydroindol-1-yl]sulfonyl]acetate |
| SMILES | [H]/N=C(\N)c1cccc(/C=C/C2Cc3cc(OC4CCN(/C(C)=N/[H])CC4)c(Cl)cc3N2S(=O)(=O)CC(=O)OCC)c1 |
| InChI | InChI=1S/C28H34ClN5O5S/c1-3-38-27(35)17-40(36,37)34-22(8-7-19-5-4-6-20(13-19)28(31)32)14-21-15-26(24(29)16-25(21)34)39-23-9-11-33(12-10-23)18(2)30/h4-8,13,15-16,22-23,30H,3,9-12,14,17H2,1-2H3,(H3,31,32)/b8-7+,30-18+ |
| InChIKey | BJTJOEQCIJWGPJ-PCRXTQSQSA-N |
| XLogP | 3.80 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.13 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|