C27H27ClN2O3S — CID 139880565
7-[5-(4-chlorocyclohexyl)oxy-1-ethylsulfonyl-2,3-dihydroindol-2-yl]naphthalene-2-carbonitrile (PubChem CID 139880565) has the molecular formula C27H27ClN2O3S and a molecular weight of 495.04 g/mol. Its IUPAC name is 7-[5-(4-chlorocyclohexyl)oxy-1-ethylsulfonyl-2,3-dihydroindol-2-yl]naphthalene-2-carbonitrile.
| Compound Name | 7-[5-(4-chlorocyclohexyl)oxy-1-ethylsulfonyl-2,3-dihydroindol-2-yl]naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139880565 |
| Molecular Formula | C27H27ClN2O3S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 7-[5-(4-chlorocyclohexyl)oxy-1-ethylsulfonyl-2,3-dihydroindol-2-yl]naphthalene-2-carbonitrile |
| SMILES | CCS(=O)(=O)N1c2ccc(OC3CCC(Cl)CC3)cc2CC1c1ccc2ccc(C#N)cc2c1 |
| InChI | InChI=1S/C27H27ClN2O3S/c1-2-34(31,32)30-26-12-11-25(33-24-9-7-23(28)8-10-24)15-22(26)16-27(30)20-6-5-19-4-3-18(17-29)13-21(19)14-20/h3-6,11-15,23-24,27H,2,7-10,16H2,1H3 |
| InChIKey | YKINEIPZKMZGKR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|