C17H24N4 — CID 140994898
1-ethyl-2-[2-[(2S)-pyrrolidin-2-yl]ethyl]indole-6-carboximidamide (PubChem CID 140994898) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 1-ethyl-2-[2-[(2S)-pyrrolidin-2-yl]ethyl]indole-6-carboximidamide.
| Compound Name | 1-ethyl-2-[2-[(2S)-pyrrolidin-2-yl]ethyl]indole-6-carboximidamide |
|---|---|
| PubChem CID | 140994898 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1-ethyl-2-[2-[(2S)-pyrrolidin-2-yl]ethyl]indole-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(CC[C@@H]3CCCN3)n(CC)c2c1 |
| InChI | InChI=1S/C17H24N4/c1-2-21-15(8-7-14-4-3-9-20-14)10-12-5-6-13(17(18)19)11-16(12)21/h5-6,10-11,14,20H,2-4,7-9H2,1H3,(H3,18,19)/t14-/m0/s1 |
| InChIKey | YOXLQGZHZFADBR-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|