C24H34N4O — CID 174335282
2-[(3S)-6-cyclopentyl-3-ethyl-4-imino-5-oxohexyl]-1-ethylindole-6-carboximidamide (PubChem CID 174335282) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-[(3S)-6-cyclopentyl-3-ethyl-4-imino-5-oxohexyl]-1-ethylindole-6-carboximidamide.
| Compound Name | 2-[(3S)-6-cyclopentyl-3-ethyl-4-imino-5-oxohexyl]-1-ethylindole-6-carboximidamide |
|---|---|
| PubChem CID | 174335282 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2-[(3S)-6-cyclopentyl-3-ethyl-4-imino-5-oxohexyl]-1-ethylindole-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(CC[C@H](CC)/C(=N/[H])C(=O)CC3CCCC3)n(CC)c2c1 |
| InChI | InChI=1S/C24H34N4O/c1-3-17(23(25)22(29)13-16-7-5-6-8-16)11-12-20-14-18-9-10-19(24(26)27)15-21(18)28(20)4-2/h9-10,14-17,25H,3-8,11-13H2,1-2H3,(H3,26,27)/b25-23-/t17-/m0/s1 |
| InChIKey | RTHACRIEAXUVIW-KZIRDTCISA-N |
| XLogP | 5.07 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|