C25H34N5O4S- — CID 174321000
(5R,8S)-10-(6-carbamimidoyl-1-ethylindol-2-yl)-5,8-diethyl-4,7-diimino-3,6-dioxodecane-1-sulfinate (PubChem CID 174321000) has the molecular formula C25H34N5O4S- and a molecular weight of 500.65 g/mol. Its IUPAC name is (5R,8S)-10-(6-carbamimidoyl-1-ethylindol-2-yl)-5,8-diethyl-4,7-diimino-3,6-dioxodecane-1-sulfinate.
| Compound Name | (5R,8S)-10-(6-carbamimidoyl-1-ethylindol-2-yl)-5,8-diethyl-4,7-diimino-3,6-dioxodecane-1-sulfinate |
|---|---|
| PubChem CID | 174321000 |
| Molecular Formula | C25H34N5O4S- |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (5R,8S)-10-(6-carbamimidoyl-1-ethylindol-2-yl)-5,8-diethyl-4,7-diimino-3,6-dioxodecane-1-sulfinate |
| SMILES | [H]/N=C(\N)c1ccc2cc(CC[C@H](CC)/C(=N/[H])C(=O)[C@H](CC)/C(=N/[H])C(=O)CCS(=O)[O-])n(CC)c2c1 |
| InChI | InChI=1S/C25H35N5O4S/c1-4-15(22(26)24(32)19(5-2)23(27)21(31)11-12-35(33)34)9-10-18-13-16-7-8-17(25(28)29)14-20(16)30(18)6-3/h7-8,13-15,19,26-27H,4-6,9-12H2,1-3H3,(H3,28,29)(H,33,34)/p-1/b26-22-,27-23-/t15-,19+/m0/s1 |
| InChIKey | FTVMDYPNWYTHIA-SSMXBWHXSA-M |
| XLogP | 3.38 |
| TPSA | 176.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|