C34H55O6P — CID 139880759
bis(3-phenoxyundecan-2-yl) hydrogen phosphate (PubChem CID 139880759) has the molecular formula C34H55O6P and a molecular weight of 590.78 g/mol. Its IUPAC name is bis(3-phenoxyundecan-2-yl) hydrogen phosphate.
| Compound Name | bis(3-phenoxyundecan-2-yl) hydrogen phosphate |
|---|---|
| PubChem CID | 139880759 |
| Molecular Formula | C34H55O6P |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | bis(3-phenoxyundecan-2-yl) hydrogen phosphate |
| SMILES | CCCCCCCCC(Oc1ccccc1)C(C)OP(=O)(O)OC(C)C(CCCCCCCC)Oc1ccccc1 |
| InChI | InChI=1S/C34H55O6P/c1-5-7-9-11-13-21-27-33(37-31-23-17-15-18-24-31)29(3)39-41(35,36)40-30(4)34(28-22-14-12-10-8-6-2)38-32-25-19-16-20-26-32/h15-20,23-26,29-30,33-34H,5-14,21-22,27-28H2,1-4H3,(H,35,36) |
| InChIKey | MMAQYIDNHVJMRI-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|