C19H36O2 — CID 139884565
2,2-bis(4-ethylhex-3-enyl)propane-1,3-diol (PubChem CID 139884565) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is 2,2-bis(4-ethylhex-3-enyl)propane-1,3-diol.
| Compound Name | 2,2-bis(4-ethylhex-3-enyl)propane-1,3-diol |
|---|---|
| PubChem CID | 139884565 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | 2,2-bis(4-ethylhex-3-enyl)propane-1,3-diol |
| SMILES | CCC(=CCCC(CO)(CO)CCC=C(CC)CC)CC |
| InChI | InChI=1S/C19H36O2/c1-5-17(6-2)11-9-13-19(15-20,16-21)14-10-12-18(7-3)8-4/h11-12,20-21H,5-10,13-16H2,1-4H3 |
| InChIKey | XUTWAJFVEPFBHB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|