C21H19Cl2N5O — CID 139888138
1-(3,4-dichlorophenyl)-N-[[2-[N-methoxy-C-(1-methylimidazol-2-yl)carbonimidoyl]phenyl]methylideneamino]ethanimine (PubChem CID 139888138) has the molecular formula C21H19Cl2N5O and a molecular weight of 428.32 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-[[2-[N-methoxy-C-(1-methylimidazol-2-yl)carbonimidoyl]phenyl]methylideneamino]ethanimine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-[[2-[N-methoxy-C-(1-methylimidazol-2-yl)carbonimidoyl]phenyl]methylideneamino]ethanimine |
|---|---|
| PubChem CID | 139888138 |
| Molecular Formula | C21H19Cl2N5O |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-[[2-[N-methoxy-C-(1-methylimidazol-2-yl)carbonimidoyl]phenyl]methylideneamino]ethanimine |
| SMILES | CON=C(c1ccccc1C=NN=C(C)c1ccc(Cl)c(Cl)c1)c1nccn1C |
| InChI | InChI=1S/C21H19Cl2N5O/c1-14(15-8-9-18(22)19(23)12-15)26-25-13-16-6-4-5-7-17(16)20(27-29-3)21-24-10-11-28(21)2/h4-13H,1-3H3 |
| InChIKey | LEPGQQUCWXKTBY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|