C17H15Cl3N4O2 — CID 143010507
methyl N-[[2-chloro-5-[(E)-N-[(E)-(2,4-dichloro-3-pyridinyl)methylideneamino]-C-methylcarbonimidoyl]phenyl]methyl]carbamate (PubChem CID 143010507) has the molecular formula C17H15Cl3N4O2 and a molecular weight of 413.69 g/mol. Its IUPAC name is methyl N-[[2-chloro-5-[(E)-N-[(E)-(2,4-dichloro-3-pyridinyl)methylideneamino]-C-methylcarbonimidoyl]phenyl]methyl]carbamate.
| Compound Name | methyl N-[[2-chloro-5-[(E)-N-[(E)-(2,4-dichloro-3-pyridinyl)methylideneamino]-C-methylcarbonimidoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 143010507 |
| Molecular Formula | C17H15Cl3N4O2 |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | methyl N-[[2-chloro-5-[(E)-N-[(E)-(2,4-dichloro-3-pyridinyl)methylideneamino]-C-methylcarbonimidoyl]phenyl]methyl]carbamate |
| SMILES | COC(=O)NCc1cc(/C(C)=N/N=C/c2c(Cl)ccnc2Cl)ccc1Cl |
| InChI | InChI=1S/C17H15Cl3N4O2/c1-10(24-23-9-13-15(19)5-6-21-16(13)20)11-3-4-14(18)12(7-11)8-22-17(25)26-2/h3-7,9H,8H2,1-2H3,(H,22,25)/b23-9+,24-10+ |
| InChIKey | CAHHLPSCUDZAKK-WDBPGAOMSA-N |
| XLogP | 4.74 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|