C19H35NO5 — CID 139889656
acetyl 4-[dodecyl(methyl)amino]-3-hydroxy-4-oxobutanoate (PubChem CID 139889656) has the molecular formula C19H35NO5 and a molecular weight of 357.49 g/mol. Its IUPAC name is acetyl 4-[dodecyl(methyl)amino]-3-hydroxy-4-oxobutanoate.
| Compound Name | acetyl 4-[dodecyl(methyl)amino]-3-hydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 139889656 |
| Molecular Formula | C19H35NO5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | acetyl 4-[dodecyl(methyl)amino]-3-hydroxy-4-oxobutanoate |
| SMILES | CCCCCCCCCCCCN(C)C(=O)C(O)CC(=O)OC(C)=O |
| InChI | InChI=1S/C19H35NO5/c1-4-5-6-7-8-9-10-11-12-13-14-20(3)19(24)17(22)15-18(23)25-16(2)21/h17,22H,4-15H2,1-3H3 |
| InChIKey | CIIUPEZEXQEOAD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|