C25H29NO2 — CID 139892150
2-[(2-aminophenyl)-(2-hydroxy-3,4,6-trimethylphenyl)methyl]-3,5,6-trimethylphenol (PubChem CID 139892150) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-[(2-aminophenyl)-(2-hydroxy-3,4,6-trimethylphenyl)methyl]-3,5,6-trimethylphenol.
| Compound Name | 2-[(2-aminophenyl)-(2-hydroxy-3,4,6-trimethylphenyl)methyl]-3,5,6-trimethylphenol |
|---|---|
| PubChem CID | 139892150 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-[(2-aminophenyl)-(2-hydroxy-3,4,6-trimethylphenyl)methyl]-3,5,6-trimethylphenol |
| SMILES | Cc1cc(C)c(C(c2ccccc2N)c2c(C)cc(C)c(C)c2O)c(O)c1C |
| InChI | InChI=1S/C25H29NO2/c1-13-11-15(3)21(24(27)17(13)5)23(19-9-7-8-10-20(19)26)22-16(4)12-14(2)18(6)25(22)28/h7-12,23,27-28H,26H2,1-6H3 |
| InChIKey | LFVVNCUEPGNXBB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|