C19H20ClN3O3 — CID 139892440
1-chloro-N-[2-(dimethylamino)ethyl]-7-methoxy-9-oxo-10H-acridine-2-carboxamide (PubChem CID 139892440) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is 1-chloro-N-[2-(dimethylamino)ethyl]-7-methoxy-9-oxo-10H-acridine-2-carboxamide.
| Compound Name | 1-chloro-N-[2-(dimethylamino)ethyl]-7-methoxy-9-oxo-10H-acridine-2-carboxamide |
|---|---|
| PubChem CID | 139892440 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-chloro-N-[2-(dimethylamino)ethyl]-7-methoxy-9-oxo-10H-acridine-2-carboxamide |
| SMILES | COc1ccc2[nH]c3ccc(C(=O)NCCN(C)C)c(Cl)c3c(=O)c2c1 |
| InChI | InChI=1S/C19H20ClN3O3/c1-23(2)9-8-21-19(25)12-5-7-15-16(17(12)20)18(24)13-10-11(26-3)4-6-14(13)22-15/h4-7,10H,8-9H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | JALXKSSDIJSPJR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|