C19H20N2O4 — CID 54752572
N-[2-(dimethylamino)ethyl]-8-methoxy-2-oxobenzo[h]chromene-3-carboxamide (PubChem CID 54752572) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-8-methoxy-2-oxobenzo[h]chromene-3-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-8-methoxy-2-oxobenzo[h]chromene-3-carboxamide |
|---|---|
| PubChem CID | 54752572 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-8-methoxy-2-oxobenzo[h]chromene-3-carboxamide |
| SMILES | COc1ccc2c(ccc3cc(C(=O)NCCN(C)C)c(=O)oc32)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-21(2)9-8-20-18(22)16-11-13-5-4-12-10-14(24-3)6-7-15(12)17(13)25-19(16)23/h4-7,10-11H,8-9H2,1-3H3,(H,20,22) |
| InChIKey | YLCZJJQNEPTITF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|