C13H16N2O4S — CID 139893324
ethyl 2-(2-methoxypyrimidin-5-yl)cyclohexa-1,3-diene-1-sulfonate (PubChem CID 139893324) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is ethyl 2-(2-methoxypyrimidin-5-yl)cyclohexa-1,3-diene-1-sulfonate.
| Compound Name | ethyl 2-(2-methoxypyrimidin-5-yl)cyclohexa-1,3-diene-1-sulfonate |
|---|---|
| PubChem CID | 139893324 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | ethyl 2-(2-methoxypyrimidin-5-yl)cyclohexa-1,3-diene-1-sulfonate |
| SMILES | CCOS(=O)(=O)C1=C(c2cnc(OC)nc2)C=CCC1 |
| InChI | InChI=1S/C13H16N2O4S/c1-3-19-20(16,17)12-7-5-4-6-11(12)10-8-14-13(18-2)15-9-10/h4,6,8-9H,3,5,7H2,1-2H3 |
| InChIKey | RRDBQLMQCZXLKI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|