C13H15ClN2O4S — CID 139893318
ethyl 4-chloro-2-(2-methoxypyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate (PubChem CID 139893318) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is ethyl 4-chloro-2-(2-methoxypyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate.
| Compound Name | ethyl 4-chloro-2-(2-methoxypyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 139893318 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | ethyl 4-chloro-2-(2-methoxypyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate |
| SMILES | CCOS(=O)(=O)C1CC=C(Cl)C=C1c1cnc(OC)nc1 |
| InChI | InChI=1S/C13H15ClN2O4S/c1-3-20-21(17,18)12-5-4-10(14)6-11(12)9-7-15-13(19-2)16-8-9/h4,6-8,12H,3,5H2,1-2H3 |
| InChIKey | XYLOMYPNEKIBQN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|