C12H14ClN3O3S — CID 139893365
ethyl 2-(2-aminopyrimidin-5-yl)-4-chlorocyclohexa-2,4-diene-1-sulfonate (PubChem CID 139893365) has the molecular formula C12H14ClN3O3S and a molecular weight of 315.78 g/mol. Its IUPAC name is ethyl 2-(2-aminopyrimidin-5-yl)-4-chlorocyclohexa-2,4-diene-1-sulfonate.
| Compound Name | ethyl 2-(2-aminopyrimidin-5-yl)-4-chlorocyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 139893365 |
| Molecular Formula | C12H14ClN3O3S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | ethyl 2-(2-aminopyrimidin-5-yl)-4-chlorocyclohexa-2,4-diene-1-sulfonate |
| SMILES | CCOS(=O)(=O)C1CC=C(Cl)C=C1c1cnc(N)nc1 |
| InChI | InChI=1S/C12H14ClN3O3S/c1-2-19-20(17,18)11-4-3-9(13)5-10(11)8-6-15-12(14)16-7-8/h3,5-7,11H,2,4H2,1H3,(H2,14,15,16) |
| InChIKey | USDHWSNQIBAWHL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|