C12H12ClN3O5S — CID 139893335
ethyl 4-chloro-2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate (PubChem CID 139893335) has the molecular formula C12H12ClN3O5S and a molecular weight of 345.76 g/mol. Its IUPAC name is ethyl 4-chloro-2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate.
| Compound Name | ethyl 4-chloro-2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 139893335 |
| Molecular Formula | C12H12ClN3O5S |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | ethyl 4-chloro-2-(2-nitropyrimidin-5-yl)cyclohexa-2,4-diene-1-sulfonate |
| SMILES | CCOS(=O)(=O)C1CC=C(Cl)C=C1c1cnc([N+](=O)[O-])nc1 |
| InChI | InChI=1S/C12H12ClN3O5S/c1-2-21-22(19,20)11-4-3-9(13)5-10(11)8-6-14-12(15-7-8)16(17)18/h3,5-7,11H,2,4H2,1H3 |
| InChIKey | FQANNNHMHGWEOS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 112.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|