C12H15N3O3S — CID 139893408
ethyl 2-(2-aminopyrimidin-5-yl)cyclohexa-1,3-diene-1-sulfonate (PubChem CID 139893408) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is ethyl 2-(2-aminopyrimidin-5-yl)cyclohexa-1,3-diene-1-sulfonate.
| Compound Name | ethyl 2-(2-aminopyrimidin-5-yl)cyclohexa-1,3-diene-1-sulfonate |
|---|---|
| PubChem CID | 139893408 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | ethyl 2-(2-aminopyrimidin-5-yl)cyclohexa-1,3-diene-1-sulfonate |
| SMILES | CCOS(=O)(=O)C1=C(c2cnc(N)nc2)C=CCC1 |
| InChI | InChI=1S/C12H15N3O3S/c1-2-18-19(16,17)11-6-4-3-5-10(11)9-7-14-12(13)15-8-9/h3,5,7-8H,2,4,6H2,1H3,(H2,13,14,15) |
| InChIKey | SVQKWVIKEPWKRM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|