C26H30F4 — CID 139893703
1,5-bis(2,2-difluoro-3,3-dimethylbutyl)anthracene (PubChem CID 139893703) has the molecular formula C26H30F4 and a molecular weight of 418.52 g/mol. Its IUPAC name is 1,5-bis(2,2-difluoro-3,3-dimethylbutyl)anthracene.
| Compound Name | 1,5-bis(2,2-difluoro-3,3-dimethylbutyl)anthracene |
|---|---|
| PubChem CID | 139893703 |
| Molecular Formula | C26H30F4 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 1,5-bis(2,2-difluoro-3,3-dimethylbutyl)anthracene |
| SMILES | CC(C)(C)C(F)(F)Cc1cccc2cc3c(CC(F)(F)C(C)(C)C)cccc3cc12 |
| InChI | InChI=1S/C26H30F4/c1-23(2,3)25(27,28)15-19-11-7-9-17-14-22-18(13-21(17)19)10-8-12-20(22)16-26(29,30)24(4,5)6/h7-14H,15-16H2,1-6H3 |
| InChIKey | YNNWXNGJCWLWFE-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|