C24H28N4O4S2Si — CID 139897169
6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl-[4-[[5-(2-trimethylsilylethynyl)-1H-indol-2-yl]sulfonyl]piperazin-1-yl]methanone (PubChem CID 139897169) has the molecular formula C24H28N4O4S2Si and a molecular weight of 528.73 g/mol. Its IUPAC name is 6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl-[4-[[5-(2-trimethylsilylethynyl)-1H-indol-2-yl]sulfonyl]piperazin-1-yl]methanone.
| Compound Name | 6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl-[4-[[5-(2-trimethylsilylethynyl)-1H-indol-2-yl]sulfonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 139897169 |
| Molecular Formula | C24H28N4O4S2Si |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl-[4-[[5-(2-trimethylsilylethynyl)-1H-indol-2-yl]sulfonyl]piperazin-1-yl]methanone |
| SMILES | C[Si](C)(C)C#Cc1ccc2[nH]c(S(=O)(=O)N3CCN(C(=O)c4nc5c(s4)COCC5)CC3)cc2c1 |
| InChI | InChI=1S/C24H28N4O4S2Si/c1-35(2,3)13-7-17-4-5-19-18(14-17)15-22(25-19)34(30,31)28-10-8-27(9-11-28)24(29)23-26-20-6-12-32-16-21(20)33-23/h4-5,14-15,25H,6,8-12,16H2,1-3H3 |
| InChIKey | NQFUOKWEEAVULW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|