C14H24O — CID 139902219
1-(1-ethoxyethenyl)-3,3,5,5-tetramethylcyclohexene (PubChem CID 139902219) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 1-(1-ethoxyethenyl)-3,3,5,5-tetramethylcyclohexene.
| Compound Name | 1-(1-ethoxyethenyl)-3,3,5,5-tetramethylcyclohexene |
|---|---|
| PubChem CID | 139902219 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1-(1-ethoxyethenyl)-3,3,5,5-tetramethylcyclohexene |
| SMILES | C=C(OCC)C1=CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H24O/c1-7-15-11(2)12-8-13(3,4)10-14(5,6)9-12/h8H,2,7,9-10H2,1,3-6H3 |
| InChIKey | DLTNBUAPAGFRHA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|