C19H28N2O2 — CID 139903087
(3S)-3-tert-butyl-N'-[(1R)-1-phenylethyl]-2-prop-2-enylbutanediamide (PubChem CID 139903087) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3S)-3-tert-butyl-N'-[(1R)-1-phenylethyl]-2-prop-2-enylbutanediamide.
| Compound Name | (3S)-3-tert-butyl-N'-[(1R)-1-phenylethyl]-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 139903087 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (3S)-3-tert-butyl-N'-[(1R)-1-phenylethyl]-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(C(N)=O)[C@H](C(=O)N[C@H](C)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H28N2O2/c1-6-10-15(17(20)22)16(19(3,4)5)18(23)21-13(2)14-11-8-7-9-12-14/h6-9,11-13,15-16H,1,10H2,2-5H3,(H2,20,22)(H,21,23)/t13-,15?,16-/m1/s1 |
| InChIKey | ILMLTKWISKEKKW-YAELJHOLSA-N |
| XLogP | 3.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|