C25H38N2O6 — CID 139906718
benzyl 4-[[4-acetyloxybutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 139906718) has the molecular formula C25H38N2O6 and a molecular weight of 462.59 g/mol. Its IUPAC name is benzyl 4-[[4-acetyloxybutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[4-acetyloxybutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139906718 |
| Molecular Formula | C25H38N2O6 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | benzyl 4-[[4-acetyloxybutyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(=O)OCCCCN(CC1CCN(C(=O)OCc2ccccc2)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H38N2O6/c1-20(28)31-17-9-8-14-27(24(30)33-25(2,3)4)18-21-12-15-26(16-13-21)23(29)32-19-22-10-6-5-7-11-22/h5-7,10-11,21H,8-9,12-19H2,1-4H3 |
| InChIKey | RLOGEQWPVROONR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|