About ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate
ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate (PubChem CID 139907517) has the molecular formula C22H14F9N3O3
and a molecular weight of 539.35 g/mol. Its IUPAC name is ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate |
| PubChem CID | 139907517 |
| Molecular Formula | C22H14F9N3O3 |
| Molecular Weight | 539.35 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(Nc3ccc(C(F)(F)F)cc3C(F)(F)F)nc(C(F)(F)F)cc2=O)cc1 |
| InChI | InChI=1S/C22H14F9N3O3/c1-2-37-18(36)11-3-6-13(7-4-11)34-17(35)10-16(22(29,30)31)33-19(34)32-15-8-5-12(20(23,24)25)9-14(15)21(26,27)28/h3-10H,2H2,1H3,(H,32,33) |
| InChIKey | PWXWJDVKCLNNMQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.35 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate?
The IUPAC name of ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate (CID 139907517) is ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate.
What is the SMILES notation for ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate?
The canonical SMILES for ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate is CCOC(=O)c1ccc(-n2c(Nc3ccc(C(F)(F)F)cc3C(F)(F)F)nc(C(F)(F)F)cc2=O)cc1.
What is the InChIKey of ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate?
The InChIKey is PWXWJDVKCLNNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14F9N3O3/c1-2-37-18(36)11-3-6-13(7-4-11)34-17(35)10-16(22(29,30)31)33-19(34)32-15-8-5-12(20(23,24)25)9-14(15)21(26,27)28/h3-10H,2H2,1H3,(H,32,33).
What are the key properties of ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate?
ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate has a molecular weight of 539.35 g/mol, XLogP of 6.21, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-[2,4-bis(trifluoromethyl)anilino]-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate is sourced from PubChem (CID 139907517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).