C20H29N3O3 — CID 139912462
ethyl 1-[(4-phenylpiperidine-4-carbonyl)amino]piperidine-3-carboxylate (PubChem CID 139912462) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is ethyl 1-[(4-phenylpiperidine-4-carbonyl)amino]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(4-phenylpiperidine-4-carbonyl)amino]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 139912462 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | ethyl 1-[(4-phenylpiperidine-4-carbonyl)amino]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(NC(=O)C2(c3ccccc3)CCNCC2)C1 |
| InChI | InChI=1S/C20H29N3O3/c1-2-26-18(24)16-7-6-14-23(15-16)22-19(25)20(10-12-21-13-11-20)17-8-4-3-5-9-17/h3-5,8-9,16,21H,2,6-7,10-15H2,1H3,(H,22,25) |
| InChIKey | JXLLRUGHAIIBLX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |