C21H23ClN4O3 — CID 139912924
N-(2-chloro-6-oxo-5H-phenanthridin-4-yl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide (PubChem CID 139912924) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-(2-chloro-6-oxo-5H-phenanthridin-4-yl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-chloro-6-oxo-5H-phenanthridin-4-yl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 139912924 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-(2-chloro-6-oxo-5H-phenanthridin-4-yl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CCO)CC1)Nc1cc(Cl)cc2c1[nH]c(=O)c1ccccc12 |
| InChI | InChI=1S/C21H23ClN4O3/c22-14-11-17-15-3-1-2-4-16(15)21(29)24-20(17)18(12-14)23-19(28)13-26-7-5-25(6-8-26)9-10-27/h1-4,11-12,27H,5-10,13H2,(H,23,28)(H,24,29) |
| InChIKey | SVPLMOLVRRLUFM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|