C36H40N2O8S — CID 139913421
tert-butyl N-[2-[4-[4,5-dioxo-3'-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]spiro[1,3-dioxa-2λ4-thiacyclopentane-2,1'-1-benzothiophene]-2'-yl]phenoxy]ethyl]carbamate (PubChem CID 139913421) has the molecular formula C36H40N2O8S and a molecular weight of 660.79 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4,5-dioxo-3'-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]spiro[1,3-dioxa-2λ4-thiacyclopentane-2,1'-1-benzothiophene]-2'-yl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4,5-dioxo-3'-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]spiro[1,3-dioxa-2λ4-thiacyclopentane-2,1'-1-benzothiophene]-2'-yl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 139913421 |
| Molecular Formula | C36H40N2O8S |
| Molecular Weight | 660.79 g/mol |
| Exact Mass | 660.25 |
| IUPAC Name | tert-butyl N-[2-[4-[4,5-dioxo-3'-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]spiro[1,3-dioxa-2λ4-thiacyclopentane-2,1'-1-benzothiophene]-2'-yl]phenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(C2=C(Cc3ccc(OCCN4CCCC4)cc3)c3ccccc3S23OC(=O)C(=O)O3)cc1 |
| InChI | InChI=1S/C36H40N2O8S/c1-36(2,3)44-35(41)37-18-22-42-28-16-12-26(13-17-28)32-30(29-8-4-5-9-31(29)47(32)45-33(39)34(40)46-47)24-25-10-14-27(15-11-25)43-23-21-38-19-6-7-20-38/h4-5,8-17H,6-7,18-24H2,1-3H3,(H,37,41) |
| InChIKey | ZMJQEXYXDCSPIQ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.79 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|