C19H32N4O3 — CID 59362866
tert-butyl N-[2-[3-amino-4-(2-pyrrolidin-1-ylethylamino)phenoxy]ethyl]carbamate (PubChem CID 59362866) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is tert-butyl N-[2-[3-amino-4-(2-pyrrolidin-1-ylethylamino)phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-amino-4-(2-pyrrolidin-1-ylethylamino)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 59362866 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | tert-butyl N-[2-[3-amino-4-(2-pyrrolidin-1-ylethylamino)phenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(NCCN2CCCC2)c(N)c1 |
| InChI | InChI=1S/C19H32N4O3/c1-19(2,3)26-18(24)22-9-13-25-15-6-7-17(16(20)14-15)21-8-12-23-10-4-5-11-23/h6-7,14,21H,4-5,8-13,20H2,1-3H3,(H,22,24) |
| InChIKey | AYYBFOXSWSHUKF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|