C20H18O4S2 — CID 139913803
(2Z)-1,1-diethoxy-2-(3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one (PubChem CID 139913803) has the molecular formula C20H18O4S2 and a molecular weight of 386.49 g/mol. Its IUPAC name is (2Z)-1,1-diethoxy-2-(3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one.
| Compound Name | (2Z)-1,1-diethoxy-2-(3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 139913803 |
| Molecular Formula | C20H18O4S2 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (2Z)-1,1-diethoxy-2-(3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one |
| SMILES | CCOS1(OCC)/C(=C2\Sc3ccccc3C2=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H18O4S2/c1-3-23-26(24-4-2)16-12-8-6-10-14(16)18(22)20(26)19-17(21)13-9-5-7-11-15(13)25-19/h5-12H,3-4H2,1-2H3/b20-19- |
| InChIKey | KDEOKBCKJLXNND-VXPUYCOJSA-N |
| XLogP | 5.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_M(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|