C25H20N2O3S2 — CID 67416369
1,1-dimethyl-3-phenylurea;(2Z)-2-(3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one (PubChem CID 67416369) has the molecular formula C25H20N2O3S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1,1-dimethyl-3-phenylurea;(2Z)-2-(3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one.
| Compound Name | 1,1-dimethyl-3-phenylurea;(2Z)-2-(3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 67416369 |
| Molecular Formula | C25H20N2O3S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 1,1-dimethyl-3-phenylurea;(2Z)-2-(3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one |
| SMILES | CN(C)C(=O)Nc1ccccc1.O=C1/C(=C2/Sc3ccccc3C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C16H8O2S2.C9H12N2O/c17-13-9-5-1-3-7-11(9)19-15(13)16-14(18)10-6-2-4-8-12(10)20-16;1-11(2)9(12)10-8-6-4-3-5-7-8/h1-8H;3-7H,1-2H3,(H,10,12)/b16-15-; |
| InChIKey | QPPGVLZDWNWUCN-YFKNTREVSA-N |
| XLogP | 5.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_M(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|