C17H20N2OS2 — CID 142853289
butane;2,3-diamino-10-methylidenebenzo[g][1,4]benzodithiin-5-one (PubChem CID 142853289) has the molecular formula C17H20N2OS2 and a molecular weight of 332.49 g/mol. Its IUPAC name is butane;2,3-diamino-10-methylidenebenzo[g][1,4]benzodithiin-5-one.
| Compound Name | butane;2,3-diamino-10-methylidenebenzo[g][1,4]benzodithiin-5-one |
|---|---|
| PubChem CID | 142853289 |
| Molecular Formula | C17H20N2OS2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | butane;2,3-diamino-10-methylidenebenzo[g][1,4]benzodithiin-5-one |
| SMILES | C=C1C2=C(SC(N)=C(N)S2)C(=O)c2ccccc21.CCCC |
| InChI | InChI=1S/C13H10N2OS2.C4H10/c1-6-7-4-2-3-5-8(7)9(16)11-10(6)17-12(14)13(15)18-11;1-3-4-2/h2-5H,1,14-15H2;3-4H2,1-2H3 |
| InChIKey | KHNDNGOEWMUPIP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |