C13H10N2OS2 — CID 142853290
2,3-diamino-10-methylidenebenzo[g][1,4]benzodithiin-5-one (PubChem CID 142853290) has the molecular formula C13H10N2OS2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 2,3-diamino-10-methylidenebenzo[g][1,4]benzodithiin-5-one.
| Compound Name | 2,3-diamino-10-methylidenebenzo[g][1,4]benzodithiin-5-one |
|---|---|
| PubChem CID | 142853290 |
| Molecular Formula | C13H10N2OS2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2,3-diamino-10-methylidenebenzo[g][1,4]benzodithiin-5-one |
| SMILES | C=C1C2=C(SC(N)=C(N)S2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C13H10N2OS2/c1-6-7-4-2-3-5-8(7)9(16)11-10(6)17-12(14)13(15)18-11/h2-5H,1,14-15H2 |
| InChIKey | ZZSXGOXVYUJAJI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |