C28H34N2O — CID 142036980
4-(butylamino)-10-methylideneanthracen-9-one;ethane;4-methylaniline (PubChem CID 142036980) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-(butylamino)-10-methylideneanthracen-9-one;ethane;4-methylaniline.
| Compound Name | 4-(butylamino)-10-methylideneanthracen-9-one;ethane;4-methylaniline |
|---|---|
| PubChem CID | 142036980 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 4-(butylamino)-10-methylideneanthracen-9-one;ethane;4-methylaniline |
| SMILES | C=C1c2ccccc2C(=O)c2cccc(NCCCC)c21.CC.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C19H19NO.C7H9N.C2H6/c1-3-4-12-20-17-11-7-10-16-18(17)13(2)14-8-5-6-9-15(14)19(16)21;1-6-2-4-7(8)5-3-6;1-2/h5-11,20H,2-4,12H2,1H3;2-5H,8H2,1H3;1-2H3 |
| InChIKey | XKTTVMSOFNLMJD-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|