C13H24O3S3Sn — CID 139915092
O-[butyl-di(propanethioyloxy)stannyl] propanethioate (PubChem CID 139915092) has the molecular formula C13H24O3S3Sn and a molecular weight of 443.24 g/mol. Its IUPAC name is O-[butyl-di(propanethioyloxy)stannyl] propanethioate.
| Compound Name | O-[butyl-di(propanethioyloxy)stannyl] propanethioate |
|---|---|
| PubChem CID | 139915092 |
| Molecular Formula | C13H24O3S3Sn |
| Molecular Weight | 443.24 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | O-[butyl-di(propanethioyloxy)stannyl] propanethioate |
| SMILES | CCCC[Sn](OC(=S)CC)(OC(=S)CC)OC(=S)CC |
| InChI | InChI=1S/C4H9.3C3H6OS.Sn/c1-3-4-2;3*1-2-3(4)5;/h1,3-4H2,2H3;3*2H2,1H3,(H,4,5);/q;;;;+3/p-3 |
| InChIKey | YEIJNSBQRZEPBE-UHFFFAOYSA-K |
| XLogP | 4.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.24 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|