C25H30O15Sn — CID 141124032
[bis[(3-acetyl-2,4-dioxopentanoyl)oxy]-butylstannyl] 3-acetyl-2,4-dioxopentanoate (PubChem CID 141124032) has the molecular formula C25H30O15Sn and a molecular weight of 689.21 g/mol. Its IUPAC name is [bis[(3-acetyl-2,4-dioxopentanoyl)oxy]-butylstannyl] 3-acetyl-2,4-dioxopentanoate.
| Compound Name | [bis[(3-acetyl-2,4-dioxopentanoyl)oxy]-butylstannyl] 3-acetyl-2,4-dioxopentanoate |
|---|---|
| PubChem CID | 141124032 |
| Molecular Formula | C25H30O15Sn |
| Molecular Weight | 689.21 g/mol |
| Exact Mass | 690.06 |
| IUPAC Name | [bis[(3-acetyl-2,4-dioxopentanoyl)oxy]-butylstannyl] 3-acetyl-2,4-dioxopentanoate |
| SMILES | CCCC[Sn](OC(=O)C(=O)C(C(C)=O)C(C)=O)(OC(=O)C(=O)C(C(C)=O)C(C)=O)OC(=O)C(=O)C(C(C)=O)C(C)=O |
| InChI | InChI=1S/3C7H8O5.C4H9.Sn/c3*1-3(8)5(4(2)9)6(10)7(11)12;1-3-4-2;/h3*5H,1-2H3,(H,11,12);1,3-4H2,2H3;/q;;;;+3/p-3 |
| InChIKey | MTXGSCJGFUGBNH-UHFFFAOYSA-K |
| XLogP | -0.56 |
| TPSA | 232.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|