C18H23AlO11 — CID 141414337
[(3-acetyl-2,4-dioxopentanoyl)oxy-butoxyalumanyl] 3-acetyl-2,4-dioxopentanoate (PubChem CID 141414337) has the molecular formula C18H23AlO11 and a molecular weight of 442.35 g/mol. Its IUPAC name is [(3-acetyl-2,4-dioxopentanoyl)oxy-butoxyalumanyl] 3-acetyl-2,4-dioxopentanoate.
| Compound Name | [(3-acetyl-2,4-dioxopentanoyl)oxy-butoxyalumanyl] 3-acetyl-2,4-dioxopentanoate |
|---|---|
| PubChem CID | 141414337 |
| Molecular Formula | C18H23AlO11 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | [(3-acetyl-2,4-dioxopentanoyl)oxy-butoxyalumanyl] 3-acetyl-2,4-dioxopentanoate |
| SMILES | CCCCO[Al](OC(=O)C(=O)C(C(C)=O)C(C)=O)OC(=O)C(=O)C(C(C)=O)C(C)=O |
| InChI | InChI=1S/2C7H8O5.C4H9O.Al/c2*1-3(8)5(4(2)9)6(10)7(11)12;1-2-3-4-5;/h2*5H,1-2H3,(H,11,12);2-4H2,1H3;/q;;-1;+3/p-2 |
| InChIKey | IPACIDUCAPLZGS-UHFFFAOYSA-L |
| XLogP | -0.40 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|